C18H26O9 — CID 10981922
1-O-[[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl] 5-O-ethyl (2R)-2-acetyl-2-methylpentanedioate (PubChem CID 10981922) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is 1-O-[[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl] 5-O-ethyl (2R)-2-acetyl-2-methylpentanedioate.
| Compound Name | 1-O-[[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl] 5-O-ethyl (2R)-2-acetyl-2-methylpentanedioate |
|---|---|
| PubChem CID | 10981922 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-O-[[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl] 5-O-ethyl (2R)-2-acetyl-2-methylpentanedioate |
| SMILES | CCOC(=O)CC[C@](C)(C(C)=O)C(=O)OC[C@H]1OC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H26O9/c1-6-23-12(20)7-8-18(5,10(2)19)16(22)24-9-11-13-14(15(21)25-11)27-17(3,4)26-13/h11,13-14H,6-9H2,1-5H3/t11-,13-,14-,18-/m1/s1 |
| InChIKey | SHLLTTJLYYORKO-XWXWGSFUSA-N |
| XLogP | 0.91 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|