C21H14FN3O4 — CID 10982042
N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-2-(4-nitrophenyl)acetamide (PubChem CID 10982042) has the molecular formula C21H14FN3O4 and a molecular weight of 391.36 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 10982042 |
| Molecular Formula | C21H14FN3O4 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccc2oc(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C21H14FN3O4/c22-15-5-3-14(4-6-15)21-24-18-12-16(7-10-19(18)29-21)23-20(26)11-13-1-8-17(9-2-13)25(27)28/h1-10,12H,11H2,(H,23,26) |
| InChIKey | DABZDJSBKDSASC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|