C22H38O4Si — CID 10982126
methyl (2R,5S,6S,7S)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-7-ethenyl-2-hydroxybicyclo[3.2.0]heptane-6-carboxylate (PubChem CID 10982126) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is methyl (2R,5S,6S,7S)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-7-ethenyl-2-hydroxybicyclo[3.2.0]heptane-6-carboxylate.
| Compound Name | methyl (2R,5S,6S,7S)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-7-ethenyl-2-hydroxybicyclo[3.2.0]heptane-6-carboxylate |
|---|---|
| PubChem CID | 10982126 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | methyl (2R,5S,6S,7S)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-7-ethenyl-2-hydroxybicyclo[3.2.0]heptane-6-carboxylate |
| SMILES | C=C[C@H]1[C@@H](C(=O)OC)[C@@H]2CC[C@@H](O)C12/C=C/CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O4Si/c1-8-16-19(20(24)25-5)17-12-13-18(23)22(16,17)14-10-9-11-15-26-27(6,7)21(2,3)4/h8,10,14,16-19,23H,1,9,11-13,15H2,2-7H3/b14-10+/t16-,17-,18+,19+,22?/m0/s1 |
| InChIKey | OVCKNTXOYPCBSP-ZDKCEWGKSA-N |
| XLogP | 4.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|