About [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate
[3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate (PubChem CID 10982190) has the molecular formula C11H10Cl5NO4
and a molecular weight of 397.47 g/mol. Its IUPAC name is [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate.
Molecular Properties
| Compound Name | [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate |
| PubChem CID | 10982190 |
| Molecular Formula | C11H10Cl5NO4 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 394.91 |
| IUPAC Name | [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate |
| SMILES | CCOc1nc(C(Cl)(Cl)Cl)c(Cl)c(OC(=O)COC)c1Cl |
| InChI | InChI=1S/C11H10Cl5NO4/c1-3-20-10-7(13)8(21-5(18)4-19-2)6(12)9(17-10)11(14,15)16/h3-4H2,1-2H3 |
| InChIKey | UHAHVNURKXYZSN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate?
The IUPAC name of [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate (CID 10982190) is [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate.
What is the SMILES notation for [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate?
The canonical SMILES for [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate is CCOc1nc(C(Cl)(Cl)Cl)c(Cl)c(OC(=O)COC)c1Cl.
What is the InChIKey of [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate?
The InChIKey is UHAHVNURKXYZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl5NO4/c1-3-20-10-7(13)8(21-5(18)4-19-2)6(12)9(17-10)11(14,15)16/h3-4H2,1-2H3.
What are the key properties of [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate?
[3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate has a molecular weight of 397.47 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dichloro-2-ethoxy-6-(trichloromethyl)-4-pyridinyl] 2-methoxyacetate is sourced from PubChem (CID 10982190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).