C18H22O8S — CID 10982212
(2S,3S,4R,5R,6S)-3,5-dihydroxy-3-methyl-4-(4-oxopentanoyloxy)-6-phenylsulfanyloxane-2-carboxylic acid (PubChem CID 10982212) has the molecular formula C18H22O8S and a molecular weight of 398.43 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-3,5-dihydroxy-3-methyl-4-(4-oxopentanoyloxy)-6-phenylsulfanyloxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R,6S)-3,5-dihydroxy-3-methyl-4-(4-oxopentanoyloxy)-6-phenylsulfanyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 10982212 |
| Molecular Formula | C18H22O8S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (2S,3S,4R,5R,6S)-3,5-dihydroxy-3-methyl-4-(4-oxopentanoyloxy)-6-phenylsulfanyloxane-2-carboxylic acid |
| SMILES | CC(=O)CCC(=O)O[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)O[C@H](C(=O)O)[C@@]1(C)O |
| InChI | InChI=1S/C18H22O8S/c1-10(19)8-9-12(20)25-14-13(21)17(27-11-6-4-3-5-7-11)26-15(16(22)23)18(14,2)24/h3-7,13-15,17,21,24H,8-9H2,1-2H3,(H,22,23)/t13-,14-,15-,17+,18+/m1/s1 |
| InChIKey | WSYQOGVWUNQICI-WGMGUUHVSA-N |
| XLogP | 0.98 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |