About methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate
methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate (PubChem CID 10982310) has the molecular formula C23H17NO6
and a molecular weight of 403.39 g/mol. Its IUPAC name is methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate |
| PubChem CID | 10982310 |
| Molecular Formula | C23H17NO6 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate |
| SMILES | COC(=O)CN1C(=O)c2ccccc2C12c1ccc(O)cc1Oc1cc(O)ccc12 |
| InChI | InChI=1S/C23H17NO6/c1-29-21(27)12-24-22(28)15-4-2-3-5-16(15)23(24)17-8-6-13(25)10-19(17)30-20-11-14(26)7-9-18(20)23/h2-11,25-26H,12H2,1H3 |
| InChIKey | SFKWAQHKNORKLK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate?
The IUPAC name of methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate (CID 10982310) is methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate.
What is the SMILES notation for methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate?
The canonical SMILES for methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate is COC(=O)CN1C(=O)c2ccccc2C12c1ccc(O)cc1Oc1cc(O)ccc12.
What is the InChIKey of methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate?
The InChIKey is SFKWAQHKNORKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO6/c1-29-21(27)12-24-22(28)15-4-2-3-5-16(15)23(24)17-8-6-13(25)10-19(17)30-20-11-14(26)7-9-18(20)23/h2-11,25-26H,12H2,1H3.
What are the key properties of methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate?
methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate has a molecular weight of 403.39 g/mol, XLogP of 3.12, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3',6'-dihydroxy-3-oxospiro[isoindole-1,9'-xanthene]-2-yl)acetate is sourced from PubChem (CID 10982310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).