About 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one
1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one (PubChem CID 10982328) has the molecular formula C14H24OSi2
and a molecular weight of 264.52 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one.
Molecular Properties
| Compound Name | 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one |
| PubChem CID | 10982328 |
| Molecular Formula | C14H24OSi2 |
| Molecular Weight | 264.52 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one |
| SMILES | C[Si](C)(C)C1=C2CCCC2=C([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C14H24OSi2/c1-16(2,3)13-10-8-7-9-11(10)14(12(13)15)17(4,5)6/h7-9H2,1-6H3 |
| InChIKey | GHRHIJZHXAYNJT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one?
The IUPAC name of 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one (CID 10982328) is 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one.
What is the SMILES notation for 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one?
The canonical SMILES for 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one is C[Si](C)(C)C1=C2CCCC2=C([Si](C)(C)C)C1=O.
What is the InChIKey of 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one?
The InChIKey is GHRHIJZHXAYNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24OSi2/c1-16(2,3)13-10-8-7-9-11(10)14(12(13)15)17(4,5)6/h7-9H2,1-6H3.
What are the key properties of 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one?
1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one has a molecular weight of 264.52 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(trimethylsilyl)-5,6-dihydro-4H-pentalen-2-one is sourced from PubChem (CID 10982328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).