C20H31NO8 — CID 10982550
(2R,3R,4S,6S,7R)-7-(2,5-dimethoxy-3-nitrophenyl)-3,4,7-trimethoxy-2,6-dimethylheptanal (PubChem CID 10982550) has the molecular formula C20H31NO8 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2R,3R,4S,6S,7R)-7-(2,5-dimethoxy-3-nitrophenyl)-3,4,7-trimethoxy-2,6-dimethylheptanal.
| Compound Name | (2R,3R,4S,6S,7R)-7-(2,5-dimethoxy-3-nitrophenyl)-3,4,7-trimethoxy-2,6-dimethylheptanal |
|---|---|
| PubChem CID | 10982550 |
| Molecular Formula | C20H31NO8 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2R,3R,4S,6S,7R)-7-(2,5-dimethoxy-3-nitrophenyl)-3,4,7-trimethoxy-2,6-dimethylheptanal |
| SMILES | COc1cc([C@H](OC)[C@@H](C)C[C@H](OC)[C@H](OC)[C@@H](C)C=O)c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H31NO8/c1-12(8-17(26-4)19(28-6)13(2)11-22)18(27-5)15-9-14(25-3)10-16(21(23)24)20(15)29-7/h9-13,17-19H,8H2,1-7H3/t12-,13-,17-,18+,19+/m0/s1 |
| InChIKey | ZLJGQEBMVXROAQ-WIOUJZMWSA-N |
| XLogP | 3.19 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|