C25H36O5 — CID 10982617
(1R,3R,4R,7S,8E,11S)-12-[(E,2R,3S)-6-carboxy-3-hydroxyhept-5-en-2-yl]-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-8,12-diene-8-carboxylic acid (PubChem CID 10982617) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (1R,3R,4R,7S,8E,11S)-12-[(E,2R,3S)-6-carboxy-3-hydroxyhept-5-en-2-yl]-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-8,12-diene-8-carboxylic acid.
| Compound Name | (1R,3R,4R,7S,8E,11S)-12-[(E,2R,3S)-6-carboxy-3-hydroxyhept-5-en-2-yl]-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-8,12-diene-8-carboxylic acid |
|---|---|
| PubChem CID | 10982617 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (1R,3R,4R,7S,8E,11S)-12-[(E,2R,3S)-6-carboxy-3-hydroxyhept-5-en-2-yl]-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-8,12-diene-8-carboxylic acid |
| SMILES | C/C(=C\C[C@H](O)[C@H](C)C1=CC[C@@]2(C)C[C@@H]3[C@H](C)CC[C@@H]3/C(C(=O)O)=C\C[C@H]12)C(=O)O |
| InChI | InChI=1S/C25H36O5/c1-14-5-7-18-19(24(29)30)8-9-21-17(11-12-25(21,4)13-20(14)18)16(3)22(26)10-6-15(2)23(27)28/h6,8,11,14,16,18,20-22,26H,5,7,9-10,12-13H2,1-4H3,(H,27,28)(H,29,30)/b15-6+,19-8+/t14-,16-,18-,20-,21-,22+,25+/m1/s1 |
| InChIKey | IHZCQHAUROKVEX-NKJOOACJSA-N |
| XLogP | 4.82 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|