C25H41FO2Si — CID 10982706
ethyl (4E,8Z,12E)-8-fluoro-4,12-dimethyl-18-trimethylsilyloctadeca-4,8,12-trien-16-ynoate (PubChem CID 10982706) has the molecular formula C25H41FO2Si and a molecular weight of 420.69 g/mol. Its IUPAC name is ethyl (4E,8Z,12E)-8-fluoro-4,12-dimethyl-18-trimethylsilyloctadeca-4,8,12-trien-16-ynoate.
| Compound Name | ethyl (4E,8Z,12E)-8-fluoro-4,12-dimethyl-18-trimethylsilyloctadeca-4,8,12-trien-16-ynoate |
|---|---|
| PubChem CID | 10982706 |
| Molecular Formula | C25H41FO2Si |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | ethyl (4E,8Z,12E)-8-fluoro-4,12-dimethyl-18-trimethylsilyloctadeca-4,8,12-trien-16-ynoate |
| SMILES | CCOC(=O)CC/C(C)=C/CC/C(F)=C/CC/C(C)=C/CCC#CC[Si](C)(C)C |
| InChI | InChI=1S/C25H41FO2Si/c1-7-28-25(27)20-19-23(3)16-13-18-24(26)17-12-15-22(2)14-10-8-9-11-21-29(4,5)6/h14,16-17H,7-8,10,12-13,15,18-21H2,1-6H3/b22-14+,23-16+,24-17- |
| InChIKey | HYPPSFKOMVQDLQ-ATGUSPFFSA-N |
| XLogP | 7.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|