C23H19F5S — CID 10982736
1,2,3,4,5-pentafluoro-6-[(1R)-2-phenylsulfanyl-1-(2,4,6-trimethylphenyl)ethyl]benzene (PubChem CID 10982736) has the molecular formula C23H19F5S and a molecular weight of 422.46 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(1R)-2-phenylsulfanyl-1-(2,4,6-trimethylphenyl)ethyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(1R)-2-phenylsulfanyl-1-(2,4,6-trimethylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 10982736 |
| Molecular Formula | C23H19F5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(1R)-2-phenylsulfanyl-1-(2,4,6-trimethylphenyl)ethyl]benzene |
| SMILES | Cc1cc(C)c([C@@H](CSc2ccccc2)c2c(F)c(F)c(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C23H19F5S/c1-12-9-13(2)17(14(3)10-12)16(11-29-15-7-5-4-6-8-15)18-19(24)21(26)23(28)22(27)20(18)25/h4-10,16H,11H2,1-3H3/t16-/m1/s1 |
| InChIKey | GYJQSXKPAVZHSX-MRXNPFEDSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|