C25H46O3Si — CID 10982755
ethyl (1R,2S,4aR,8aS)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-1,3-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 10982755) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is ethyl (1R,2S,4aR,8aS)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-1,3-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1R,2S,4aR,8aS)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-1,3-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10982755 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | ethyl (1R,2S,4aR,8aS)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-1,3-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)[C@@H](C[C@@H](CC)O[Si](C)(C)C(C)(C)C)C(C)=C[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C25H46O3Si/c1-10-20(28-29(8,9)24(4,5)6)17-22-18(3)16-19-14-12-13-15-21(19)25(22,7)23(26)27-11-2/h16,19-22H,10-15,17H2,1-9H3/t19-,20-,21+,22+,25-/m1/s1 |
| InChIKey | MGVDHMSAIKODGH-SHNSKLSNSA-N |
| XLogP | 7.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|