C22H36O6Si — CID 10982789
methyl (1aS,4R,4aS,7S,8R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1a-methyl-5-oxo-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydronaphtho[1,8a-b]oxirene-4a-carboxylate (PubChem CID 10982789) has the molecular formula C22H36O6Si and a molecular weight of 424.61 g/mol. Its IUPAC name is methyl (1aS,4R,4aS,7S,8R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1a-methyl-5-oxo-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydronaphtho[1,8a-b]oxirene-4a-carboxylate.
| Compound Name | methyl (1aS,4R,4aS,7S,8R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1a-methyl-5-oxo-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydronaphtho[1,8a-b]oxirene-4a-carboxylate |
|---|---|
| PubChem CID | 10982789 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | methyl (1aS,4R,4aS,7S,8R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1a-methyl-5-oxo-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydronaphtho[1,8a-b]oxirene-4a-carboxylate |
| SMILES | C=C(C)[C@@H]1CC(=O)[C@]2(C(=O)OC)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]3(C)O[C@]23[C@@H]1O |
| InChI | InChI=1S/C22H36O6Si/c1-13(2)14-12-15(23)21(18(25)26-7)16(27-29(8,9)19(3,4)5)10-11-20(6)22(21,28-20)17(14)24/h14,16-17,24H,1,10-12H2,2-9H3/t14-,16+,17+,20-,21+,22-/m0/s1 |
| InChIKey | CHDZVPFJHDKXTP-VRUKAZJFSA-N |
| XLogP | 3.38 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|