C21H24N6O5 — CID 10983044
2-azido-1-[5-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 10983044) has the molecular formula C21H24N6O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-azido-1-[5-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 2-azido-1-[5-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 10983044 |
| Molecular Formula | C21H24N6O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-azido-1-[5-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | COc1cc(C2OC(c3ccc(N(C)C)cc3)=NN2C(=O)CN=[N+]=[N-])cc(OC)c1OC |
| InChI | InChI=1S/C21H24N6O5/c1-26(2)15-8-6-13(7-9-15)20-24-27(18(28)12-23-25-22)21(32-20)14-10-16(29-3)19(31-5)17(11-14)30-4/h6-11,21H,12H2,1-5H3 |
| InChIKey | ATLVETIUCNNJGX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 121.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|