About (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride
(1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride (PubChem CID 10983247) has the molecular formula C22H19Cl3NOP
and a molecular weight of 450.73 g/mol. Its IUPAC name is (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride.
Molecular Properties
| Compound Name | (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride |
| PubChem CID | 10983247 |
| Molecular Formula | C22H19Cl3NOP |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride |
| SMILES | CC(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H18Cl2NOP.ClH/c1-17(26)25-22(21(23)24)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16H,1H3;1H |
| InChIKey | YQACJOJZVNOTOK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride?
The IUPAC name of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride (CID 10983247) is (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride.
What is the SMILES notation for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride?
The canonical SMILES for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride is CC(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride?
The InChIKey is YQACJOJZVNOTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2NOP.ClH/c1-17(26)25-22(21(23)24)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16H,1H3;1H.
What are the key properties of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride?
(1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride has a molecular weight of 450.73 g/mol, XLogP of 1.72, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium chloride is sourced from PubChem (CID 10983247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).