C23H23Cl2N5O — CID 10983330
2-(2,6-dichloroanilino)-7-[(E)-3-(ethylamino)prop-1-enyl]-1,6-dimethyl-8H-imidazo[4,5-h]isoquinolin-9-one (PubChem CID 10983330) has the molecular formula C23H23Cl2N5O and a molecular weight of 456.38 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-7-[(E)-3-(ethylamino)prop-1-enyl]-1,6-dimethyl-8H-imidazo[4,5-h]isoquinolin-9-one.
| Compound Name | 2-(2,6-dichloroanilino)-7-[(E)-3-(ethylamino)prop-1-enyl]-1,6-dimethyl-8H-imidazo[4,5-h]isoquinolin-9-one |
|---|---|
| PubChem CID | 10983330 |
| Molecular Formula | C23H23Cl2N5O |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-(2,6-dichloroanilino)-7-[(E)-3-(ethylamino)prop-1-enyl]-1,6-dimethyl-8H-imidazo[4,5-h]isoquinolin-9-one |
| SMILES | CCNC/C=C/c1[nH]c(=O)c2c(ccc3nc(Nc4c(Cl)cccc4Cl)n(C)c32)c1C |
| InChI | InChI=1S/C23H23Cl2N5O/c1-4-26-12-6-9-17-13(2)14-10-11-18-21(19(14)22(31)27-17)30(3)23(28-18)29-20-15(24)7-5-8-16(20)25/h5-11,26H,4,12H2,1-3H3,(H,27,31)(H,28,29)/b9-6+ |
| InChIKey | INTMKTCZPSHRQO-RMKNXTFCSA-N |
| XLogP | 5.40 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|