C25H48O5Si — CID 10983342
tert-butyl-[(Z,1R)-1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]non-3-enoxy]-dimethylsilane (PubChem CID 10983342) has the molecular formula C25H48O5Si and a molecular weight of 456.74 g/mol. Its IUPAC name is tert-butyl-[(Z,1R)-1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]non-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,1R)-1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]non-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10983342 |
| Molecular Formula | C25H48O5Si |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | tert-butyl-[(Z,1R)-1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]non-3-enoxy]-dimethylsilane |
| SMILES | CCCCC/C=C\C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H48O5Si/c1-11-12-13-14-15-16-17-19(30-31(9,10)23(2,3)4)21-22(29-25(7,8)28-21)20-18-26-24(5,6)27-20/h15-16,19-22H,11-14,17-18H2,1-10H3/b16-15-/t19-,20-,21-,22-/m1/s1 |
| InChIKey | NAZUBYIWVILKEF-DHJWSSKUSA-N |
| XLogP | 6.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|