C22H21N5O7 — CID 10983505
(3R,7R)-3-ethyl-7-methyl-N,6-bis(4-nitrophenyl)-5-oxo-3,7-dihydro-2H-[1,3]oxazolo[3,2-c]pyrimidine-8-carboxamide (PubChem CID 10983505) has the molecular formula C22H21N5O7 and a molecular weight of 467.44 g/mol. Its IUPAC name is (3R,7R)-3-ethyl-7-methyl-N,6-bis(4-nitrophenyl)-5-oxo-3,7-dihydro-2H-[1,3]oxazolo[3,2-c]pyrimidine-8-carboxamide.
| Compound Name | (3R,7R)-3-ethyl-7-methyl-N,6-bis(4-nitrophenyl)-5-oxo-3,7-dihydro-2H-[1,3]oxazolo[3,2-c]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 10983505 |
| Molecular Formula | C22H21N5O7 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (3R,7R)-3-ethyl-7-methyl-N,6-bis(4-nitrophenyl)-5-oxo-3,7-dihydro-2H-[1,3]oxazolo[3,2-c]pyrimidine-8-carboxamide |
| SMILES | CC[C@@H]1COC2=C(C(=O)Nc3ccc([N+](=O)[O-])cc3)[C@@H](C)N(c3ccc([N+](=O)[O-])cc3)C(=O)N21 |
| InChI | InChI=1S/C22H21N5O7/c1-3-15-12-34-21-19(20(28)23-14-4-6-17(7-5-14)26(30)31)13(2)24(22(29)25(15)21)16-8-10-18(11-9-16)27(32)33/h4-11,13,15H,3,12H2,1-2H3,(H,23,28)/t13-,15-/m1/s1 |
| InChIKey | TZLMCSRXYUNBFN-UKRRQHHQSA-N |
| XLogP | 3.79 |
| TPSA | 148.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|