C26H50O5Si — CID 10983565
(5R,7S)-7-[(4S,5S)-2,2-ditert-butyl-5-ethyl-1,3,2-dioxasilinan-4-yl]-1,1-diethoxy-5-methyloct-2-yn-4-ol (PubChem CID 10983565) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is (5R,7S)-7-[(4S,5S)-2,2-ditert-butyl-5-ethyl-1,3,2-dioxasilinan-4-yl]-1,1-diethoxy-5-methyloct-2-yn-4-ol.
| Compound Name | (5R,7S)-7-[(4S,5S)-2,2-ditert-butyl-5-ethyl-1,3,2-dioxasilinan-4-yl]-1,1-diethoxy-5-methyloct-2-yn-4-ol |
|---|---|
| PubChem CID | 10983565 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (5R,7S)-7-[(4S,5S)-2,2-ditert-butyl-5-ethyl-1,3,2-dioxasilinan-4-yl]-1,1-diethoxy-5-methyloct-2-yn-4-ol |
| SMILES | CCOC(C#CC(O)[C@H](C)C[C@H](C)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)OC[C@@H]1CC)OCC |
| InChI | InChI=1S/C26H50O5Si/c1-12-21-18-30-32(25(6,7)8,26(9,10)11)31-24(21)20(5)17-19(4)22(27)15-16-23(28-13-2)29-14-3/h19-24,27H,12-14,17-18H2,1-11H3/t19-,20+,21+,22?,24+/m1/s1 |
| InChIKey | HMMILVWEXPLFNX-LCYKWENLSA-N |
| XLogP | 5.90 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|