C25H43BrO3 — CID 10983569
(6E,10E,14E)-3-bromo-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-6,10,14-trien-2-ol (PubChem CID 10983569) has the molecular formula C25H43BrO3 and a molecular weight of 471.52 g/mol. Its IUPAC name is (6E,10E,14E)-3-bromo-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-6,10,14-trien-2-ol.
| Compound Name | (6E,10E,14E)-3-bromo-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-6,10,14-trien-2-ol |
|---|---|
| PubChem CID | 10983569 |
| Molecular Formula | C25H43BrO3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | (6E,10E,14E)-3-bromo-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-6,10,14-trien-2-ol |
| SMILES | C/C(=C\CC/C(C)=C/COC1CCCCO1)CC/C=C(\C)CCC(Br)C(C)(C)O |
| InChI | InChI=1S/C25H43BrO3/c1-20(10-8-12-21(2)15-16-23(26)25(4,5)27)11-9-13-22(3)17-19-29-24-14-6-7-18-28-24/h11-12,17,23-24,27H,6-10,13-16,18-19H2,1-5H3/b20-11+,21-12+,22-17+ |
| InChIKey | ZVSRWSJPNIDQAR-NZOUBEIYSA-N |
| XLogP | 7.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|