C28H36O5S — CID 10983733
(2S,3Z)-6-(benzenesulfonyl)-8-hexyl-2-(2-phenylmethoxyethyl)-5,6-dihydro-2H-oxocin-7-one (PubChem CID 10983733) has the molecular formula C28H36O5S and a molecular weight of 484.66 g/mol. Its IUPAC name is (2S,3Z)-6-(benzenesulfonyl)-8-hexyl-2-(2-phenylmethoxyethyl)-5,6-dihydro-2H-oxocin-7-one.
| Compound Name | (2S,3Z)-6-(benzenesulfonyl)-8-hexyl-2-(2-phenylmethoxyethyl)-5,6-dihydro-2H-oxocin-7-one |
|---|---|
| PubChem CID | 10983733 |
| Molecular Formula | C28H36O5S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (2S,3Z)-6-(benzenesulfonyl)-8-hexyl-2-(2-phenylmethoxyethyl)-5,6-dihydro-2H-oxocin-7-one |
| SMILES | CCCCCCC1O[C@@H](CCOCc2ccccc2)/C=C\CC(S(=O)(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C28H36O5S/c1-2-3-4-11-18-26-28(29)27(34(30,31)25-16-9-6-10-17-25)19-12-15-24(33-26)20-21-32-22-23-13-7-5-8-14-23/h5-10,12-17,24,26-27H,2-4,11,18-22H2,1H3/b15-12-/t24-,26?,27?/m1/s1 |
| InChIKey | JBZITXRNULCERJ-BMRKNWFVSA-N |
| XLogP | 5.69 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|