C28H34N2O6 — CID 10983848
tert-butyl N-[7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5,7-dioxo-6-phenylheptyl]carbamate (PubChem CID 10983848) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is tert-butyl N-[7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5,7-dioxo-6-phenylheptyl]carbamate.
| Compound Name | tert-butyl N-[7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5,7-dioxo-6-phenylheptyl]carbamate |
|---|---|
| PubChem CID | 10983848 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | tert-butyl N-[7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5,7-dioxo-6-phenylheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)C(C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34N2O6/c1-28(2,3)36-26(33)29-17-11-10-16-23(31)24(21-14-8-5-9-15-21)25(32)30-22(19-35-27(30)34)18-20-12-6-4-7-13-20/h4-9,12-15,22,24H,10-11,16-19H2,1-3H3,(H,29,33)/t22-,24?/m0/s1 |
| InChIKey | VGABDBSTPRKJIU-OWJIYDKWSA-N |
| XLogP | 4.62 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|