C30H30O8 — CID 10984140
[(2R,3R,4R,5S)-4,5-diacetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate (PubChem CID 10984140) has the molecular formula C30H30O8 and a molecular weight of 518.56 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4,5-diacetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-4,5-diacetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10984140 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [(2R,3R,4R,5S)-4,5-diacetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H30O8/c1-20(31)35-27-26(38-29(37-22(3)33)28(27)36-21(2)32)19-34-30(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,26-29H,19H2,1-3H3/t26-,27-,28-,29-/m1/s1 |
| InChIKey | VSTZPGHVUIYDQE-CXDXLJMYSA-N |
| XLogP | 4.15 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|