C28H38O11 — CID 10984466
[(1S,2R,3S,4R,7S,8Z,10R,12R,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-14-yl] acetate (PubChem CID 10984466) has the molecular formula C28H38O11 and a molecular weight of 550.60 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8Z,10R,12R,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-14-yl] acetate.
| Compound Name | [(1S,2R,3S,4R,7S,8Z,10R,12R,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-14-yl] acetate |
|---|---|
| PubChem CID | 10984466 |
| Molecular Formula | C28H38O11 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8Z,10R,12R,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C(C)[C@@H]2[C@@H](OC(C)=O)[C@@]3(O)[C@H](/C=C(/C)[C@H](OC(C)=O)C[C@@H](OC(C)=O)[C@@]12C)OC(=O)[C@@H]3C |
| InChI | InChI=1S/C28H38O11/c1-13-9-10-21(36-17(5)30)27(8)22(37-18(6)31)12-20(35-16(4)29)14(2)11-23-28(34,15(3)26(33)39-23)25(24(13)27)38-19(7)32/h9,11,15,20-25,34H,10,12H2,1-8H3/b14-11-/t15-,20+,21-,22+,23-,24+,25+,27+,28-/m0/s1 |
| InChIKey | HTWLWEWBMJYXQL-NKVWIPEVSA-N |
| XLogP | 2.33 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|