C40H58O5Si — CID 10985126
methyl (5R)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(1S,2R)-2-[(E)-2-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]ethenyl]cyclopropyl]pentanoate (PubChem CID 10985126) has the molecular formula C40H58O5Si and a molecular weight of 646.99 g/mol. Its IUPAC name is methyl (5R)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(1S,2R)-2-[(E)-2-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]ethenyl]cyclopropyl]pentanoate.
| Compound Name | methyl (5R)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(1S,2R)-2-[(E)-2-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]ethenyl]cyclopropyl]pentanoate |
|---|---|
| PubChem CID | 10985126 |
| Molecular Formula | C40H58O5Si |
| Molecular Weight | 646.99 g/mol |
| Exact Mass | 646.41 |
| IUPAC Name | methyl (5R)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(1S,2R)-2-[(E)-2-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]ethenyl]cyclopropyl]pentanoate |
| SMILES | CCCCC/C=C\C[C@@H]1OC(C)(C)O[C@@H]1/C=C/[C@H]1C[C@@H]1[C@@H](CCCC(=O)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H58O5Si/c1-8-9-10-11-12-19-25-36-37(44-40(5,6)43-36)29-28-31-30-34(31)35(26-20-27-38(41)42-7)45-46(39(2,3)4,32-21-15-13-16-22-32)33-23-17-14-18-24-33/h12-19,21-24,28-29,31,34-37H,8-11,20,25-27,30H2,1-7H3/b19-12-,29-28+/t31-,34-,35+,36-,37+/m0/s1 |
| InChIKey | JKHINLDOIIZEFC-MRVHJONXSA-N |
| XLogP | 8.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.99 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|