C28H47IO7Si — CID 10985148
(1S,3R,5R,7R,9R,13S,14S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-9-[(E)-2-iodoethenyl]-3-methoxy-5,8,8,14-tetramethyl-10,17,18-trioxatricyclo[11.3.1.13,7]octadecane-4,11-dione (PubChem CID 10985148) has the molecular formula C28H47IO7Si and a molecular weight of 650.67 g/mol. Its IUPAC name is (1S,3R,5R,7R,9R,13S,14S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-9-[(E)-2-iodoethenyl]-3-methoxy-5,8,8,14-tetramethyl-10,17,18-trioxatricyclo[11.3.1.13,7]octadecane-4,11-dione.
| Compound Name | (1S,3R,5R,7R,9R,13S,14S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-9-[(E)-2-iodoethenyl]-3-methoxy-5,8,8,14-tetramethyl-10,17,18-trioxatricyclo[11.3.1.13,7]octadecane-4,11-dione |
|---|---|
| PubChem CID | 10985148 |
| Molecular Formula | C28H47IO7Si |
| Molecular Weight | 650.67 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | (1S,3R,5R,7R,9R,13S,14S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-9-[(E)-2-iodoethenyl]-3-methoxy-5,8,8,14-tetramethyl-10,17,18-trioxatricyclo[11.3.1.13,7]octadecane-4,11-dione |
| SMILES | CO[C@@]12C[C@@H]3C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](CC(=O)O[C@H](/C=C/I)C(C)(C)[C@@H](C[C@@H](C)C1=O)O2)O3 |
| InChI | InChI=1S/C28H47IO7Si/c1-17-13-23-27(6,7)22(11-12-29)34-24(30)15-20-18(2)21(36-37(9,10)26(3,4)5)14-19(33-20)16-28(32-8,35-23)25(17)31/h11-12,17-23H,13-16H2,1-10H3/b12-11+/t17-,18+,19+,20+,21+,22-,23-,28-/m1/s1 |
| InChIKey | OMLDITJXGMNKDL-ODOQHQBJSA-N |
| XLogP | 6.19 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|