C42H63N9 — CID 10985333
2-N,4-N,6-N-tris[4-(5-methylhexan-2-ylamino)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 10985333) has the molecular formula C42H63N9 and a molecular weight of 694.03 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris[4-(5-methylhexan-2-ylamino)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris[4-(5-methylhexan-2-ylamino)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 10985333 |
| Molecular Formula | C42H63N9 |
| Molecular Weight | 694.03 g/mol |
| Exact Mass | 693.52 |
| IUPAC Name | 2-N,4-N,6-N-tris[4-(5-methylhexan-2-ylamino)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)CCC(C)Nc1ccc(Nc2nc(Nc3ccc(NC(C)CCC(C)C)cc3)nc(Nc3ccc(NC(C)CCC(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C42H63N9/c1-28(2)10-13-31(7)43-34-16-22-37(23-17-34)46-40-49-41(47-38-24-18-35(19-25-38)44-32(8)14-11-29(3)4)51-42(50-40)48-39-26-20-36(21-27-39)45-33(9)15-12-30(5)6/h16-33,43-45H,10-15H2,1-9H3,(H3,46,47,48,49,50,51) |
| InChIKey | BONQQGMOTXODRC-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.03 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |