C47H34N2O3S2 — CID 10985485
2,7,12-tris(4-methoxyphenyl)-17-phenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaene (PubChem CID 10985485) has the molecular formula C47H34N2O3S2 and a molecular weight of 738.93 g/mol. Its IUPAC name is 2,7,12-tris(4-methoxyphenyl)-17-phenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaene.
| Compound Name | 2,7,12-tris(4-methoxyphenyl)-17-phenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaene |
|---|---|
| PubChem CID | 10985485 |
| Molecular Formula | C47H34N2O3S2 |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.20 |
| IUPAC Name | 2,7,12-tris(4-methoxyphenyl)-17-phenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaene |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc(s4)c(-c4ccc(OC)cc4)c4nc(c(-c5ccccc5)c5ccc2s5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H34N2O3S2/c1-50-33-15-9-30(10-16-33)45-37-22-21-36(48-37)44(29-7-5-4-6-8-29)40-25-26-41(53-40)46(31-11-17-34(51-2)18-12-31)38-23-24-39(49-38)47(43-28-27-42(45)54-43)32-13-19-35(52-3)20-14-32/h4-28H,1-3H3/b44-36-,44-40-,45-37-,45-42-,46-38-,46-41-,47-39-,47-43- |
| InChIKey | VDVGAHYPACBROB-PPOYENJCSA-N |
| XLogP | 12.82 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |