C35H50Br2N4O4 — CID 10985525
6-[dimethyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]azaniumyl]hexyl-[3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropyl]-dimethylazanium dibromide (PubChem CID 10985525) has the molecular formula C35H50Br2N4O4 and a molecular weight of 750.62 g/mol. Its IUPAC name is 6-[dimethyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]azaniumyl]hexyl-[3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropyl]-dimethylazanium dibromide.
| Compound Name | 6-[dimethyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]azaniumyl]hexyl-[3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 10985525 |
| Molecular Formula | C35H50Br2N4O4 |
| Molecular Weight | 750.62 g/mol |
| Exact Mass | 748.22 |
| IUPAC Name | 6-[dimethyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]azaniumyl]hexyl-[3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropyl]-dimethylazanium dibromide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC[N+](C)(C)CCCCCC[N+](C)(C)CC(C)(C)CN1C(=O)c3ccccc3C1=O)C2=O.[Br-].[Br-] |
| InChI | InChI=1S/C35H50N4O4.2BrH/c1-26-17-18-29-30(23-26)34(43)36(31(29)40)19-14-22-38(4,5)20-12-8-9-13-21-39(6,7)25-35(2,3)24-37-32(41)27-15-10-11-16-28(27)33(37)42;;/h10-11,15-18,23H,8-9,12-14,19-22,24-25H2,1-7H3;2*1H/q+2;;/p-2 |
| InChIKey | TXDSVLKDLCIXPJ-UHFFFAOYSA-L |
| XLogP | -0.98 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.62 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|