About deuterio(triethyl)silane
deuterio(triethyl)silane (PubChem CID 10986198) has the molecular formula C6H16Si
and a molecular weight of 117.29 g/mol. Its IUPAC name is deuterio(triethyl)silane.
Molecular Properties
| Compound Name | deuterio(triethyl)silane |
| PubChem CID | 10986198 |
| Molecular Formula | C6H16Si |
| Molecular Weight | 117.29 g/mol |
| Exact Mass | 117.11 |
| IUPAC Name | deuterio(triethyl)silane |
| SMILES | [2H][Si](CC)(CC)CC |
| InChI | InChI=1S/C6H16Si/c1-4-7(5-2)6-3/h7H,4-6H2,1-3H3/i7D |
| InChIKey | AQRLNPVMDITEJU-WHRKIXHSSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze deuterio(triethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterio(triethyl)silane?
The IUPAC name of deuterio(triethyl)silane (CID 10986198) is deuterio(triethyl)silane.
What is the SMILES notation for deuterio(triethyl)silane?
The canonical SMILES for deuterio(triethyl)silane is [2H][Si](CC)(CC)CC.
What is the InChIKey of deuterio(triethyl)silane?
The InChIKey is AQRLNPVMDITEJU-WHRKIXHSSA-N. The full InChI is InChI=1S/C6H16Si/c1-4-7(5-2)6-3/h7H,4-6H2,1-3H3/i7D.
What are the key properties of deuterio(triethyl)silane?
deuterio(triethyl)silane has a molecular weight of 117.29 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for deuterio(triethyl)silane is sourced from PubChem (CID 10986198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).