C8H15N — CID 10986225
(8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 10986225) has the molecular formula C8H15N and a molecular weight of 125.22 g/mol. Its IUPAC name is (8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 10986225 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C8H15N/c1-2-6-9-7-3-5-8(9)4-1/h8H,1-7H2/t8-/m0/s1 |
| InChIKey | HAJKHJOABGFIGP-QMMMGPOBSA-N |
| XLogP | 1.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |