About 1,2-diethynylcyclohexene
1,2-diethynylcyclohexene (PubChem CID 10986251) has the molecular formula C10H10
and a molecular weight of 130.19 g/mol. Its IUPAC name is 1,2-diethynylcyclohexene.
Molecular Properties
| Compound Name | 1,2-diethynylcyclohexene |
| PubChem CID | 10986251 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 1,2-diethynylcyclohexene |
| SMILES | C#CC1=C(C#C)CCCC1 |
| InChI | InChI=1S/C10H10/c1-3-9-7-5-6-8-10(9)4-2/h1-2H,5-8H2 |
| InChIKey | BTAQCZNRMSONHM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethynylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethynylcyclohexene?
The IUPAC name of 1,2-diethynylcyclohexene (CID 10986251) is 1,2-diethynylcyclohexene.
What is the SMILES notation for 1,2-diethynylcyclohexene?
The canonical SMILES for 1,2-diethynylcyclohexene is C#CC1=C(C#C)CCCC1.
What is the InChIKey of 1,2-diethynylcyclohexene?
The InChIKey is BTAQCZNRMSONHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10/c1-3-9-7-5-6-8-10(9)4-2/h1-2H,5-8H2.
What are the key properties of 1,2-diethynylcyclohexene?
1,2-diethynylcyclohexene has a molecular weight of 130.19 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethynylcyclohexene is sourced from PubChem (CID 10986251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).