(E)-4-methylpent-2-enoyl chloride

C6H9ClO — CID 10986269

IUPAC(E)-4-methylpent-2-enoyl chloride
SMILESCC(C)/C=C/C(=O)Cl
InChIInChI=1S/C6H9ClO/c1-5(2)3-4-6(7)8/h3-5H,1-2H3/b4-3+
InChIKeyOUJMZCPIRVTFCV-ONEGZZNKSA-N
MW132.59 g/mol
LogP1.96
Rot. Bonds2

About (E)-4-methylpent-2-enoyl chloride

(E)-4-methylpent-2-enoyl chloride (PubChem CID 10986269) has the molecular formula C6H9ClO and a molecular weight of 132.59 g/mol. Its IUPAC name is (E)-4-methylpent-2-enoyl chloride.

Molecular Properties

Compound Name(E)-4-methylpent-2-enoyl chloride
PubChem CID10986269
Molecular FormulaC6H9ClO
Molecular Weight132.59 g/mol
Exact Mass132.03
IUPAC Name(E)-4-methylpent-2-enoyl chloride
SMILESCC(C)/C=C/C(=O)Cl
InChIInChI=1S/C6H9ClO/c1-5(2)3-4-6(7)8/h3-5H,1-2H3/b4-3+
InChIKeyOUJMZCPIRVTFCV-ONEGZZNKSA-N
XLogP1.96
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.59
LogP ≤ 51.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-methylpent-2-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-methylpent-2-enoyl chloride?
The IUPAC name of (E)-4-methylpent-2-enoyl chloride (CID 10986269) is (E)-4-methylpent-2-enoyl chloride.
What is the SMILES notation for (E)-4-methylpent-2-enoyl chloride?
The canonical SMILES for (E)-4-methylpent-2-enoyl chloride is CC(C)/C=C/C(=O)Cl.
What is the InChIKey of (E)-4-methylpent-2-enoyl chloride?
The InChIKey is OUJMZCPIRVTFCV-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H9ClO/c1-5(2)3-4-6(7)8/h3-5H,1-2H3/b4-3+.
What are the key properties of (E)-4-methylpent-2-enoyl chloride?
(E)-4-methylpent-2-enoyl chloride has a molecular weight of 132.59 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-methylpent-2-enoyl chloride is sourced from PubChem (CID 10986269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).