About 2-methoxycyclohepta-2,4,6-trien-1-imine
2-methoxycyclohepta-2,4,6-trien-1-imine (PubChem CID 10986283) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-methoxycyclohepta-2,4,6-trien-1-imine.
Molecular Properties
| Compound Name | 2-methoxycyclohepta-2,4,6-trien-1-imine |
| PubChem CID | 10986283 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-methoxycyclohepta-2,4,6-trien-1-imine |
| SMILES | [H]/N=c1\cccccc1OC |
| InChI | InChI=1S/C8H9NO/c1-10-8-6-4-2-3-5-7(8)9/h2-6,9H,1H3/b9-7+ |
| InChIKey | KGDZPKGCXAIVRM-VQHVLOKHSA-N |
| XLogP | 1.17 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxycyclohepta-2,4,6-trien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxycyclohepta-2,4,6-trien-1-imine?
The IUPAC name of 2-methoxycyclohepta-2,4,6-trien-1-imine (CID 10986283) is 2-methoxycyclohepta-2,4,6-trien-1-imine.
What is the SMILES notation for 2-methoxycyclohepta-2,4,6-trien-1-imine?
The canonical SMILES for 2-methoxycyclohepta-2,4,6-trien-1-imine is [H]/N=c1\cccccc1OC.
What is the InChIKey of 2-methoxycyclohepta-2,4,6-trien-1-imine?
The InChIKey is KGDZPKGCXAIVRM-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H9NO/c1-10-8-6-4-2-3-5-7(8)9/h2-6,9H,1H3/b9-7+.
What are the key properties of 2-methoxycyclohepta-2,4,6-trien-1-imine?
2-methoxycyclohepta-2,4,6-trien-1-imine has a molecular weight of 135.17 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxycyclohepta-2,4,6-trien-1-imine is sourced from PubChem (CID 10986283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).