About (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one
(8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 10986294) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
Molecular Properties
| Compound Name | (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
| PubChem CID | 10986294 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C=C1CCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C8H11NO/c1-6-4-5-9-7(6)2-3-8(9)10/h7H,1-5H2/t7-/m0/s1 |
| InChIKey | MAYLSFNCHCZGQS-ZETCQYMHSA-N |
| XLogP | 0.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one?
The IUPAC name of (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (CID 10986294) is (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
What is the SMILES notation for (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one?
The canonical SMILES for (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one is C=C1CCN2C(=O)CC[C@@H]12.
What is the InChIKey of (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one?
The InChIKey is MAYLSFNCHCZGQS-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H11NO/c1-6-4-5-9-7(6)2-3-8(9)10/h7H,1-5H2/t7-/m0/s1.
What are the key properties of (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one?
(8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one has a molecular weight of 137.18 g/mol, XLogP of 0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-7-methylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one is sourced from PubChem (CID 10986294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).