C10H16O — CID 10986438
(1S)-1-cyclohexylbuta-2,3-dien-1-ol (PubChem CID 10986438) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1S)-1-cyclohexylbuta-2,3-dien-1-ol.
| Compound Name | (1S)-1-cyclohexylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 10986438 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1S)-1-cyclohexylbuta-2,3-dien-1-ol |
| SMILES | C=C=C[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C10H16O/c1-2-6-10(11)9-7-4-3-5-8-9/h6,9-11H,1,3-5,7-8H2/t10-/m1/s1 |
| InChIKey | VWIZIXVRCHGPIP-SNVBAGLBSA-N |
| XLogP | 2.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |