C9H16O2 — CID 10986487
(1R,4S)-2,6,6-trimethylcyclohex-2-ene-1,4-diol (PubChem CID 10986487) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (1R,4S)-2,6,6-trimethylcyclohex-2-ene-1,4-diol.
| Compound Name | (1R,4S)-2,6,6-trimethylcyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 10986487 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (1R,4S)-2,6,6-trimethylcyclohex-2-ene-1,4-diol |
| SMILES | CC1=C[C@@H](O)CC(C)(C)[C@H]1O |
| InChI | InChI=1S/C9H16O2/c1-6-4-7(10)5-9(2,3)8(6)11/h4,7-8,10-11H,5H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | GVYFIMKMHDHRLF-SFYZADRCSA-N |
| XLogP | 1.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|