About 2-azido-1-phenylethanone
2-azido-1-phenylethanone (PubChem CID 10986553) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-azido-1-phenylethanone.
Molecular Properties
| Compound Name | 2-azido-1-phenylethanone |
| PubChem CID | 10986553 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 2-azido-1-phenylethanone |
| SMILES | [N-]=[N+]=NCC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H7N3O/c9-11-10-6-8(12)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | WRDIOBBSDOAUDU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-1-phenylethanone?
The IUPAC name of 2-azido-1-phenylethanone (CID 10986553) is 2-azido-1-phenylethanone.
What is the SMILES notation for 2-azido-1-phenylethanone?
The canonical SMILES for 2-azido-1-phenylethanone is [N-]=[N+]=NCC(=O)c1ccccc1.
What is the InChIKey of 2-azido-1-phenylethanone?
The InChIKey is WRDIOBBSDOAUDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-11-10-6-8(12)7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of 2-azido-1-phenylethanone?
2-azido-1-phenylethanone has a molecular weight of 161.16 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1-phenylethanone is sourced from PubChem (CID 10986553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).