About 5-ethoxy-1,2,4-dithiazol-3-one
5-ethoxy-1,2,4-dithiazol-3-one (PubChem CID 10986576) has the molecular formula C4H5NO2S2
and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-ethoxy-1,2,4-dithiazol-3-one.
Molecular Properties
| Compound Name | 5-ethoxy-1,2,4-dithiazol-3-one |
| PubChem CID | 10986576 |
| Molecular Formula | C4H5NO2S2 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 162.98 |
| IUPAC Name | 5-ethoxy-1,2,4-dithiazol-3-one |
| SMILES | CCOc1nc(=O)ss1 |
| InChI | InChI=1S/C4H5NO2S2/c1-2-7-4-5-3(6)8-9-4/h2H2,1H3 |
| InChIKey | RZIJZXUDFRSADE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethoxy-1,2,4-dithiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-1,2,4-dithiazol-3-one?
The IUPAC name of 5-ethoxy-1,2,4-dithiazol-3-one (CID 10986576) is 5-ethoxy-1,2,4-dithiazol-3-one.
What is the SMILES notation for 5-ethoxy-1,2,4-dithiazol-3-one?
The canonical SMILES for 5-ethoxy-1,2,4-dithiazol-3-one is CCOc1nc(=O)ss1.
What is the InChIKey of 5-ethoxy-1,2,4-dithiazol-3-one?
The InChIKey is RZIJZXUDFRSADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S2/c1-2-7-4-5-3(6)8-9-4/h2H2,1H3.
What are the key properties of 5-ethoxy-1,2,4-dithiazol-3-one?
5-ethoxy-1,2,4-dithiazol-3-one has a molecular weight of 163.22 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-1,2,4-dithiazol-3-one is sourced from PubChem (CID 10986576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).