C26H30O4 — CID 1098666
bis(2-methylpropyl) (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate (PubChem CID 1098666) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is bis(2-methylpropyl) (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate.
| Compound Name | bis(2-methylpropyl) (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 1098666 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | bis(2-methylpropyl) (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate |
| SMILES | CC(C)COC(=O)[C@@H]1C2c3ccccc3C(c3ccccc32)[C@H]1C(=O)OCC(C)C |
| InChI | InChI=1S/C26H30O4/c1-15(2)13-29-25(27)23-21-17-9-5-7-11-19(17)22(20-12-8-6-10-18(20)21)24(23)26(28)30-14-16(3)4/h5-12,15-16,21-24H,13-14H2,1-4H3/t21?,22?,23-,24-/m1/s1 |
| InChIKey | RKFQXNUDFLXOKP-SNDHGLFQSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |