About (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide
(2E)-2-(2,3-dihydroinden-1-ylidene)acetamide (PubChem CID 10986759) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide.
Molecular Properties
| Compound Name | (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide |
| PubChem CID | 10986759 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide |
| SMILES | NC(=O)/C=C1\CCc2ccccc21 |
| InChI | InChI=1S/C11H11NO/c12-11(13)7-9-6-5-8-3-1-2-4-10(8)9/h1-4,7H,5-6H2,(H2,12,13)/b9-7+ |
| InChIKey | LFYXPROOUKWVTO-VQHVLOKHSA-N |
| XLogP | 1.50 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide?
The IUPAC name of (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide (CID 10986759) is (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide.
What is the SMILES notation for (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide?
The canonical SMILES for (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide is NC(=O)/C=C1\CCc2ccccc21.
What is the InChIKey of (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide?
The InChIKey is LFYXPROOUKWVTO-VQHVLOKHSA-N. The full InChI is InChI=1S/C11H11NO/c12-11(13)7-9-6-5-8-3-1-2-4-10(8)9/h1-4,7H,5-6H2,(H2,12,13)/b9-7+.
What are the key properties of (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide?
(2E)-2-(2,3-dihydroinden-1-ylidene)acetamide has a molecular weight of 173.22 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(2,3-dihydroinden-1-ylidene)acetamide is sourced from PubChem (CID 10986759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).