C10H14O3 — CID 10986912
(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-en-4-yn-1-ol (PubChem CID 10986912) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-en-4-yn-1-ol.
| Compound Name | (E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-en-4-yn-1-ol |
|---|---|
| PubChem CID | 10986912 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-en-4-yn-1-ol |
| SMILES | C#C/C=C/[C@@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H14O3/c1-4-5-6-8(11)9-7-12-10(2,3)13-9/h1,5-6,8-9,11H,7H2,2-3H3/b6-5+/t8-,9-/m1/s1 |
| InChIKey | IUNYHPHMIISFEZ-JKKBLNIGSA-N |
| XLogP | 0.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|