About 9-methylphenanthridine
9-methylphenanthridine (PubChem CID 10987123) has the molecular formula C14H11N
and a molecular weight of 193.25 g/mol. Its IUPAC name is 9-methylphenanthridine.
Molecular Properties
| Compound Name | 9-methylphenanthridine |
| PubChem CID | 10987123 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 9-methylphenanthridine |
| SMILES | Cc1ccc2cnc3ccccc3c2c1 |
| InChI | InChI=1S/C14H11N/c1-10-6-7-11-9-15-14-5-3-2-4-12(14)13(11)8-10/h2-9H,1H3 |
| InChIKey | DWWFVBWGMXKEMS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-methylphenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylphenanthridine?
The IUPAC name of 9-methylphenanthridine (CID 10987123) is 9-methylphenanthridine.
What is the SMILES notation for 9-methylphenanthridine?
The canonical SMILES for 9-methylphenanthridine is Cc1ccc2cnc3ccccc3c2c1.
What is the InChIKey of 9-methylphenanthridine?
The InChIKey is DWWFVBWGMXKEMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N/c1-10-6-7-11-9-15-14-5-3-2-4-12(14)13(11)8-10/h2-9H,1H3.
What are the key properties of 9-methylphenanthridine?
9-methylphenanthridine has a molecular weight of 193.25 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylphenanthridine is sourced from PubChem (CID 10987123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).