C12H18O2 — CID 10987139
(4E,9E)-5,9-dimethyl-1-oxacycloundeca-4,9-dien-2-one (PubChem CID 10987139) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (4E,9E)-5,9-dimethyl-1-oxacycloundeca-4,9-dien-2-one.
| Compound Name | (4E,9E)-5,9-dimethyl-1-oxacycloundeca-4,9-dien-2-one |
|---|---|
| PubChem CID | 10987139 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (4E,9E)-5,9-dimethyl-1-oxacycloundeca-4,9-dien-2-one |
| SMILES | C/C1=C\COC(=O)C/C=C(\C)CCC1 |
| InChI | InChI=1S/C12H18O2/c1-10-4-3-5-11(2)8-9-14-12(13)7-6-10/h6,8H,3-5,7,9H2,1-2H3/b10-6+,11-8+ |
| InChIKey | RVKDTQISXMBQEU-NSJFVGFPSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|