C11H16O3 — CID 10987182
methyl (3aR,4S,5S,6aR)-5-hydroxy-4-methyl-3,3a,4,5,6,6a-hexahydropentalene-1-carboxylate (PubChem CID 10987182) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl (3aR,4S,5S,6aR)-5-hydroxy-4-methyl-3,3a,4,5,6,6a-hexahydropentalene-1-carboxylate.
| Compound Name | methyl (3aR,4S,5S,6aR)-5-hydroxy-4-methyl-3,3a,4,5,6,6a-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 10987182 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | methyl (3aR,4S,5S,6aR)-5-hydroxy-4-methyl-3,3a,4,5,6,6a-hexahydropentalene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@H]2[C@H](C)[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C11H16O3/c1-6-7-3-4-8(11(13)14-2)9(7)5-10(6)12/h4,6-7,9-10,12H,3,5H2,1-2H3/t6-,7-,9+,10-/m0/s1 |
| InChIKey | NVVSARDPXJBKDU-MFDQJXRNSA-N |
| XLogP | 1.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |