About 3-bromo-2-ethoxypyridine
3-bromo-2-ethoxypyridine (PubChem CID 10987308) has the molecular formula C7H8BrNO
and a molecular weight of 202.05 g/mol. Its IUPAC name is 3-bromo-2-ethoxypyridine.
Molecular Properties
| Compound Name | 3-bromo-2-ethoxypyridine |
| PubChem CID | 10987308 |
| Molecular Formula | C7H8BrNO |
| Molecular Weight | 202.05 g/mol |
| Exact Mass | 200.98 |
| IUPAC Name | 3-bromo-2-ethoxypyridine |
| SMILES | CCOc1ncccc1Br |
| InChI | InChI=1S/C7H8BrNO/c1-2-10-7-6(8)4-3-5-9-7/h3-5H,2H2,1H3 |
| InChIKey | KLQBFCAXXZMOLZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.05 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-2-ethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-ethoxypyridine?
The IUPAC name of 3-bromo-2-ethoxypyridine (CID 10987308) is 3-bromo-2-ethoxypyridine.
What is the SMILES notation for 3-bromo-2-ethoxypyridine?
The canonical SMILES for 3-bromo-2-ethoxypyridine is CCOc1ncccc1Br.
What is the InChIKey of 3-bromo-2-ethoxypyridine?
The InChIKey is KLQBFCAXXZMOLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO/c1-2-10-7-6(8)4-3-5-9-7/h3-5H,2H2,1H3.
What are the key properties of 3-bromo-2-ethoxypyridine?
3-bromo-2-ethoxypyridine has a molecular weight of 202.05 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-ethoxypyridine is sourced from PubChem (CID 10987308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).