C14H25N — CID 10987473
(2S,6S)-6-hexyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine (PubChem CID 10987473) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (2S,6S)-6-hexyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine.
| Compound Name | (2S,6S)-6-hexyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 10987473 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (2S,6S)-6-hexyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
| SMILES | C=CC[C@H]1CC=C[C@H](CCCCCC)N1 |
| InChI | InChI=1S/C14H25N/c1-3-5-6-7-10-14-12-8-11-13(15-14)9-4-2/h4,8,12-15H,2-3,5-7,9-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | YQIAHXZAMPEKSU-KBPBESRZSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|