C12H18O3 — CID 10987533
(1'R,5'S)-5,5-dimethylspiro[1,3-dioxane-2,3'-8-oxabicyclo[3.2.1]oct-6-ene] (PubChem CID 10987533) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1'R,5'S)-5,5-dimethylspiro[1,3-dioxane-2,3'-8-oxabicyclo[3.2.1]oct-6-ene].
| Compound Name | (1'R,5'S)-5,5-dimethylspiro[1,3-dioxane-2,3'-8-oxabicyclo[3.2.1]oct-6-ene] |
|---|---|
| PubChem CID | 10987533 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1'R,5'S)-5,5-dimethylspiro[1,3-dioxane-2,3'-8-oxabicyclo[3.2.1]oct-6-ene] |
| SMILES | CC1(C)COC2(C[C@H]3C=C[C@@H](C2)O3)OC1 |
| InChI | InChI=1S/C12H18O3/c1-11(2)7-13-12(14-8-11)5-9-3-4-10(6-12)15-9/h3-4,9-10H,5-8H2,1-2H3/t9-,10+ |
| InChIKey | MMICQKYZIFUSFX-AOOOYVTPSA-N |
| XLogP | 1.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|