C13H14BrN3O4 — CID 1098767
2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetohydrazide (PubChem CID 1098767) has the molecular formula C13H14BrN3O4 and a molecular weight of 356.18 g/mol. Its IUPAC name is 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetohydrazide.
| Compound Name | 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetohydrazide |
|---|---|
| PubChem CID | 1098767 |
| Molecular Formula | C13H14BrN3O4 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetohydrazide |
| SMILES | NNC(=O)CN1C(=O)C2(OCCCO2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C13H14BrN3O4/c14-8-2-3-10-9(6-8)13(20-4-1-5-21-13)12(19)17(10)7-11(18)16-15/h2-3,6H,1,4-5,7,15H2,(H,16,18) |
| InChIKey | DSYWLFKDEVGRQG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|