About 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine
4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine (PubChem CID 10987705) has the molecular formula C5HClF4N2O
and a molecular weight of 216.52 g/mol. Its IUPAC name is 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine.
Molecular Properties
| Compound Name | 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine |
| PubChem CID | 10987705 |
| Molecular Formula | C5HClF4N2O |
| Molecular Weight | 216.52 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine |
| SMILES | Fc1cc(OC(F)(F)Cl)nc(F)n1 |
| InChI | InChI=1S/C5HClF4N2O/c6-5(9,10)13-3-1-2(7)11-4(8)12-3/h1H |
| InChIKey | HVXIUKASJQAPLW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine?
The IUPAC name of 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine (CID 10987705) is 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine.
What is the SMILES notation for 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine?
The canonical SMILES for 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine is Fc1cc(OC(F)(F)Cl)nc(F)n1.
What is the InChIKey of 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine?
The InChIKey is HVXIUKASJQAPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HClF4N2O/c6-5(9,10)13-3-1-2(7)11-4(8)12-3/h1H.
What are the key properties of 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine?
4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine has a molecular weight of 216.52 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[chloro(difluoro)methoxy]-2,6-difluoropyrimidine is sourced from PubChem (CID 10987705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).